About [4-[(1,3-diethylpyrazol-5-yl)methyl]piperidin-4-yl]methanol
[4-[(1,3-diethylpyrazol-5-yl)methyl]piperidin-4-yl]methanol (PubChem CID 66025190) has the molecular formula C14H25N3O
and a molecular weight of 251.37 g/mol. Its IUPAC name is [4-[(1,3-diethylpyrazol-5-yl)methyl]piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [4-[(1,3-diethylpyrazol-5-yl)methyl]piperidin-4-yl]methanol |
| PubChem CID | 66025190 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | [4-[(1,3-diethylpyrazol-5-yl)methyl]piperidin-4-yl]methanol |
| SMILES | CCc1cc(CC2(CO)CCNCC2)n(CC)n1 |
| InChI | InChI=1S/C14H25N3O/c1-3-12-9-13(17(4-2)16-12)10-14(11-18)5-7-15-8-6-14/h9,15,18H,3-8,10-11H2,1-2H3 |
| InChIKey | OPNYIQSVXBFIRF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(1,3-diethylpyrazol-5-yl)methyl]piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(1,3-diethylpyrazol-5-yl)methyl]piperidin-4-yl]methanol?
The IUPAC name of [4-[(1,3-diethylpyrazol-5-yl)methyl]piperidin-4-yl]methanol (CID 66025190) is [4-[(1,3-diethylpyrazol-5-yl)methyl]piperidin-4-yl]methanol.
What is the SMILES notation for [4-[(1,3-diethylpyrazol-5-yl)methyl]piperidin-4-yl]methanol?
The canonical SMILES for [4-[(1,3-diethylpyrazol-5-yl)methyl]piperidin-4-yl]methanol is CCc1cc(CC2(CO)CCNCC2)n(CC)n1.
What is the InChIKey of [4-[(1,3-diethylpyrazol-5-yl)methyl]piperidin-4-yl]methanol?
The InChIKey is OPNYIQSVXBFIRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O/c1-3-12-9-13(17(4-2)16-12)10-14(11-18)5-7-15-8-6-14/h9,15,18H,3-8,10-11H2,1-2H3.
What are the key properties of [4-[(1,3-diethylpyrazol-5-yl)methyl]piperidin-4-yl]methanol?
[4-[(1,3-diethylpyrazol-5-yl)methyl]piperidin-4-yl]methanol has a molecular weight of 251.37 g/mol, XLogP of 1.37, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(1,3-diethylpyrazol-5-yl)methyl]piperidin-4-yl]methanol is sourced from PubChem (CID 66025190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).