About 1-[benzyl(methyl)amino]propan-2-yl thiophene-2-carboxylate;hydrochloride
1-[benzyl(methyl)amino]propan-2-yl thiophene-2-carboxylate;hydrochloride (PubChem CID 6602582) has the molecular formula C16H20ClNO2S
and a molecular weight of 325.86 g/mol. Its IUPAC name is 1-[benzyl(methyl)amino]propan-2-yl thiophene-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 1-[benzyl(methyl)amino]propan-2-yl thiophene-2-carboxylate;hydrochloride |
| PubChem CID | 6602582 |
| Molecular Formula | C16H20ClNO2S |
| Molecular Weight | 325.86 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 1-[benzyl(methyl)amino]propan-2-yl thiophene-2-carboxylate;hydrochloride |
| SMILES | CC(CN(C)Cc1ccccc1)OC(=O)c1cccs1.Cl |
| InChI | InChI=1S/C16H19NO2S.ClH/c1-13(19-16(18)15-9-6-10-20-15)11-17(2)12-14-7-4-3-5-8-14;/h3-10,13H,11-12H2,1-2H3;1H |
| InChIKey | KJPGRBHLJCSBOS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.86 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[benzyl(methyl)amino]propan-2-yl thiophene-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[benzyl(methyl)amino]propan-2-yl thiophene-2-carboxylate;hydrochloride?
The IUPAC name of 1-[benzyl(methyl)amino]propan-2-yl thiophene-2-carboxylate;hydrochloride (CID 6602582) is 1-[benzyl(methyl)amino]propan-2-yl thiophene-2-carboxylate;hydrochloride.
What is the SMILES notation for 1-[benzyl(methyl)amino]propan-2-yl thiophene-2-carboxylate;hydrochloride?
The canonical SMILES for 1-[benzyl(methyl)amino]propan-2-yl thiophene-2-carboxylate;hydrochloride is CC(CN(C)Cc1ccccc1)OC(=O)c1cccs1.Cl.
What is the InChIKey of 1-[benzyl(methyl)amino]propan-2-yl thiophene-2-carboxylate;hydrochloride?
The InChIKey is KJPGRBHLJCSBOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2S.ClH/c1-13(19-16(18)15-9-6-10-20-15)11-17(2)12-14-7-4-3-5-8-14;/h3-10,13H,11-12H2,1-2H3;1H.
What are the key properties of 1-[benzyl(methyl)amino]propan-2-yl thiophene-2-carboxylate;hydrochloride?
1-[benzyl(methyl)amino]propan-2-yl thiophene-2-carboxylate;hydrochloride has a molecular weight of 325.86 g/mol, XLogP of 3.85, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[benzyl(methyl)amino]propan-2-yl thiophene-2-carboxylate;hydrochloride is sourced from PubChem (CID 6602582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).