About 2-pyrrolidin-1-ylethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride
2-pyrrolidin-1-ylethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride (PubChem CID 6602605) has the molecular formula C18H26ClNO2
and a molecular weight of 323.86 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-pyrrolidin-1-ylethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride |
| PubChem CID | 6602605 |
| Molecular Formula | C18H26ClNO2 |
| Molecular Weight | 323.86 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-pyrrolidin-1-ylethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCCN1CCCC1)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C18H25NO2.ClH/c20-17(21-15-14-19-12-6-7-13-19)18(10-4-5-11-18)16-8-2-1-3-9-16;/h1-3,8-9H,4-7,10-15H2;1H |
| InChIKey | JFVKVWBDXGXZAZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.86 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyrrolidin-1-ylethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-1-ylethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride?
The IUPAC name of 2-pyrrolidin-1-ylethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride (CID 6602605) is 2-pyrrolidin-1-ylethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride.
What is the SMILES notation for 2-pyrrolidin-1-ylethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride?
The canonical SMILES for 2-pyrrolidin-1-ylethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride is Cl.O=C(OCCN1CCCC1)C1(c2ccccc2)CCCC1.
What is the InChIKey of 2-pyrrolidin-1-ylethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride?
The InChIKey is JFVKVWBDXGXZAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO2.ClH/c20-17(21-15-14-19-12-6-7-13-19)18(10-4-5-11-18)16-8-2-1-3-9-16;/h1-3,8-9H,4-7,10-15H2;1H.
What are the key properties of 2-pyrrolidin-1-ylethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride?
2-pyrrolidin-1-ylethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride has a molecular weight of 323.86 g/mol, XLogP of 3.56, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-1-ylethyl 1-phenylcyclopentane-1-carboxylate;hydrochloride is sourced from PubChem (CID 6602605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).