C19H37ClN6 — CID 6602632
1-[1-(1-tert-butyltetrazol-5-yl)-3-methylbutyl]-4-cyclopentylpiperazine;hydrochloride (PubChem CID 6602632) has the molecular formula C19H37ClN6 and a molecular weight of 385.00 g/mol. Its IUPAC name is 1-[1-(1-tert-butyltetrazol-5-yl)-3-methylbutyl]-4-cyclopentylpiperazine;hydrochloride.
| Compound Name | 1-[1-(1-tert-butyltetrazol-5-yl)-3-methylbutyl]-4-cyclopentylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 6602632 |
| Molecular Formula | C19H37ClN6 |
| Molecular Weight | 385.00 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 1-[1-(1-tert-butyltetrazol-5-yl)-3-methylbutyl]-4-cyclopentylpiperazine;hydrochloride |
| SMILES | CC(C)CC(c1nnnn1C(C)(C)C)N1CCN(C2CCCC2)CC1.Cl |
| InChI | InChI=1S/C19H36N6.ClH/c1-15(2)14-17(18-20-21-22-25(18)19(3,4)5)24-12-10-23(11-13-24)16-8-6-7-9-16;/h15-17H,6-14H2,1-5H3;1H |
| InChIKey | HHWBFJAUFFHYSP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.00 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |