About 2-(4-ethoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one;hydrochloride
2-(4-ethoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one;hydrochloride (PubChem CID 6602659) has the molecular formula C17H20ClN3O2S
and a molecular weight of 365.89 g/mol. Its IUPAC name is 2-(4-ethoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one;hydrochloride.
Molecular Properties
| Compound Name | 2-(4-ethoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one;hydrochloride |
| PubChem CID | 6602659 |
| Molecular Formula | C17H20ClN3O2S |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2-(4-ethoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one;hydrochloride |
| SMILES | CCOc1ccc(NC2=NCCC(=O)N2Cc2cccs2)cc1.Cl |
| InChI | InChI=1S/C17H19N3O2S.ClH/c1-2-22-14-7-5-13(6-8-14)19-17-18-10-9-16(21)20(17)12-15-4-3-11-23-15;/h3-8,11H,2,9-10,12H2,1H3,(H,18,19);1H |
| InChIKey | LNHZNWZFEDGAJR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-ethoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one;hydrochloride?
The IUPAC name of 2-(4-ethoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one;hydrochloride (CID 6602659) is 2-(4-ethoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one;hydrochloride.
What is the SMILES notation for 2-(4-ethoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one;hydrochloride?
The canonical SMILES for 2-(4-ethoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one;hydrochloride is CCOc1ccc(NC2=NCCC(=O)N2Cc2cccs2)cc1.Cl.
What is the InChIKey of 2-(4-ethoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one;hydrochloride?
The InChIKey is LNHZNWZFEDGAJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O2S.ClH/c1-2-22-14-7-5-13(6-8-14)19-17-18-10-9-16(21)20(17)12-15-4-3-11-23-15;/h3-8,11H,2,9-10,12H2,1H3,(H,18,19);1H.
What are the key properties of 2-(4-ethoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one;hydrochloride?
2-(4-ethoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one;hydrochloride has a molecular weight of 365.89 g/mol, XLogP of 3.77, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one;hydrochloride is sourced from PubChem (CID 6602659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).