C10H17F3O4S — CID 66026738
2-(1,1-dioxothiolan-3-yl)-4-(2,2,2-trifluoroethoxy)butan-1-ol (PubChem CID 66026738) has the molecular formula C10H17F3O4S and a molecular weight of 290.30 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-4-(2,2,2-trifluoroethoxy)butan-1-ol.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-4-(2,2,2-trifluoroethoxy)butan-1-ol |
|---|---|
| PubChem CID | 66026738 |
| Molecular Formula | C10H17F3O4S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-4-(2,2,2-trifluoroethoxy)butan-1-ol |
| SMILES | O=S1(=O)CCC(C(CO)CCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C10H17F3O4S/c11-10(12,13)7-17-3-1-8(5-14)9-2-4-18(15,16)6-9/h8-9,14H,1-7H2 |
| InChIKey | BJJJEYIFMUYNOL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|