About 2-(2,5-dimethylanilino)-1-[(4-methoxyphenyl)methyl]-4H-imidazol-5-one;hydrochloride
2-(2,5-dimethylanilino)-1-[(4-methoxyphenyl)methyl]-4H-imidazol-5-one;hydrochloride (PubChem CID 6602689) has the molecular formula C19H22ClN3O2
and a molecular weight of 359.86 g/mol. Its IUPAC name is 2-(2,5-dimethylanilino)-1-[(4-methoxyphenyl)methyl]-4H-imidazol-5-one;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,5-dimethylanilino)-1-[(4-methoxyphenyl)methyl]-4H-imidazol-5-one;hydrochloride |
| PubChem CID | 6602689 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-(2,5-dimethylanilino)-1-[(4-methoxyphenyl)methyl]-4H-imidazol-5-one;hydrochloride |
| SMILES | COc1ccc(CN2C(=O)CN=C2Nc2cc(C)ccc2C)cc1.Cl |
| InChI | InChI=1S/C19H21N3O2.ClH/c1-13-4-5-14(2)17(10-13)21-19-20-11-18(23)22(19)12-15-6-8-16(24-3)9-7-15;/h4-10H,11-12H2,1-3H3,(H,20,21);1H |
| InChIKey | VXCIKAFQWJECOU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,5-dimethylanilino)-1-[(4-methoxyphenyl)methyl]-4H-imidazol-5-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylanilino)-1-[(4-methoxyphenyl)methyl]-4H-imidazol-5-one;hydrochloride?
The IUPAC name of 2-(2,5-dimethylanilino)-1-[(4-methoxyphenyl)methyl]-4H-imidazol-5-one;hydrochloride (CID 6602689) is 2-(2,5-dimethylanilino)-1-[(4-methoxyphenyl)methyl]-4H-imidazol-5-one;hydrochloride.
What is the SMILES notation for 2-(2,5-dimethylanilino)-1-[(4-methoxyphenyl)methyl]-4H-imidazol-5-one;hydrochloride?
The canonical SMILES for 2-(2,5-dimethylanilino)-1-[(4-methoxyphenyl)methyl]-4H-imidazol-5-one;hydrochloride is COc1ccc(CN2C(=O)CN=C2Nc2cc(C)ccc2C)cc1.Cl.
What is the InChIKey of 2-(2,5-dimethylanilino)-1-[(4-methoxyphenyl)methyl]-4H-imidazol-5-one;hydrochloride?
The InChIKey is VXCIKAFQWJECOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O2.ClH/c1-13-4-5-14(2)17(10-13)21-19-20-11-18(23)22(19)12-15-6-8-16(24-3)9-7-15;/h4-10H,11-12H2,1-3H3,(H,20,21);1H.
What are the key properties of 2-(2,5-dimethylanilino)-1-[(4-methoxyphenyl)methyl]-4H-imidazol-5-one;hydrochloride?
2-(2,5-dimethylanilino)-1-[(4-methoxyphenyl)methyl]-4H-imidazol-5-one;hydrochloride has a molecular weight of 359.86 g/mol, XLogP of 3.54, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylanilino)-1-[(4-methoxyphenyl)methyl]-4H-imidazol-5-one;hydrochloride is sourced from PubChem (CID 6602689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).