C13H20ClN — CID 6602717
2,4,7,8-tetramethyl-1,2,3,4-tetrahydroquinoline;hydrochloride (PubChem CID 6602717) has the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. Its IUPAC name is 2,4,7,8-tetramethyl-1,2,3,4-tetrahydroquinoline;hydrochloride.
| Compound Name | 2,4,7,8-tetramethyl-1,2,3,4-tetrahydroquinoline;hydrochloride |
|---|---|
| PubChem CID | 6602717 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2,4,7,8-tetramethyl-1,2,3,4-tetrahydroquinoline;hydrochloride |
| SMILES | Cc1ccc2c(c1C)NC(C)CC2C.Cl |
| InChI | InChI=1S/C13H19N.ClH/c1-8-5-6-12-9(2)7-10(3)14-13(12)11(8)4;/h5-6,9-10,14H,7H2,1-4H3;1H |
| InChIKey | WYYACMZHVQKUGZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |