C14H24N4O — CID 66027455
5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-3-methyl-1-propylpyrazol-4-amine (PubChem CID 66027455) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-3-methyl-1-propylpyrazol-4-amine.
| Compound Name | 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-3-methyl-1-propylpyrazol-4-amine |
|---|---|
| PubChem CID | 66027455 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-3-methyl-1-propylpyrazol-4-amine |
| SMILES | CCCn1nc(C)c(N)c1N1CCOC2CCCC21 |
| InChI | InChI=1S/C14H24N4O/c1-3-7-18-14(13(15)10(2)16-18)17-8-9-19-12-6-4-5-11(12)17/h11-12H,3-9,15H2,1-2H3 |
| InChIKey | SBBOFYUAMHLYGE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |