About 1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol iodide
1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol iodide (PubChem CID 6602768) has the molecular formula C7H12ClIN2O
and a molecular weight of 302.54 g/mol. Its IUPAC name is 1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol iodide.
Molecular Properties
| Compound Name | 1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol iodide |
| PubChem CID | 6602768 |
| Molecular Formula | C7H12ClIN2O |
| Molecular Weight | 302.54 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol iodide |
| SMILES | CC(O)c1n(C)c(Cl)c[n+]1C.[I-] |
| InChI | InChI=1S/C7H12ClN2O.HI/c1-5(11)7-9(2)4-6(8)10(7)3;/h4-5,11H,1-3H3;1H/q+1;/p-1 |
| InChIKey | GPCFGSBHPLITGI-UHFFFAOYSA-M |
| XLogP | -2.44 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.54 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol iodide?
The IUPAC name of 1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol iodide (CID 6602768) is 1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol iodide.
What is the SMILES notation for 1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol iodide?
The canonical SMILES for 1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol iodide is CC(O)c1n(C)c(Cl)c[n+]1C.[I-].
What is the InChIKey of 1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol iodide?
The InChIKey is GPCFGSBHPLITGI-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H12ClN2O.HI/c1-5(11)7-9(2)4-6(8)10(7)3;/h4-5,11H,1-3H3;1H/q+1;/p-1.
What are the key properties of 1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol iodide?
1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol iodide has a molecular weight of 302.54 g/mol, XLogP of -2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-1,3-dimethylimidazol-1-ium-2-yl)ethanol iodide is sourced from PubChem (CID 6602768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).