C17H18N2O2S — CID 660280
2-(2-hydroxyphenyl)-3-methyl-1,2,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 660280) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-3-methyl-1,2,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(2-hydroxyphenyl)-3-methyl-1,2,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 660280 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-(2-hydroxyphenyl)-3-methyl-1,2,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CN1C(=O)c2c(sc3c2CCCC3)NC1c1ccccc1O |
| InChI | InChI=1S/C17H18N2O2S/c1-19-15(10-6-2-4-8-12(10)20)18-16-14(17(19)21)11-7-3-5-9-13(11)22-16/h2,4,6,8,15,18,20H,3,5,7,9H2,1H3 |
| InChIKey | XTTLCCJIPCNMHW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|