About N,2-diethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride
N,2-diethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride (PubChem CID 6602800) has the molecular formula C14H16ClN3O
and a molecular weight of 277.76 g/mol. Its IUPAC name is N,2-diethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | N,2-diethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride |
| PubChem CID | 6602800 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | N,2-diethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride |
| SMILES | CCNc1nc(CC)nc2c1oc1ccccc12.Cl |
| InChI | InChI=1S/C14H15N3O.ClH/c1-3-11-16-12-9-7-5-6-8-10(9)18-13(12)14(17-11)15-4-2;/h5-8H,3-4H2,1-2H3,(H,15,16,17);1H |
| InChIKey | MJDCOJFWWUMFPS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,2-diethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-diethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride?
The IUPAC name of N,2-diethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride (CID 6602800) is N,2-diethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride.
What is the SMILES notation for N,2-diethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride?
The canonical SMILES for N,2-diethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride is CCNc1nc(CC)nc2c1oc1ccccc12.Cl.
What is the InChIKey of N,2-diethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride?
The InChIKey is MJDCOJFWWUMFPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O.ClH/c1-3-11-16-12-9-7-5-6-8-10(9)18-13(12)14(17-11)15-4-2;/h5-8H,3-4H2,1-2H3,(H,15,16,17);1H.
What are the key properties of N,2-diethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride?
N,2-diethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride has a molecular weight of 277.76 g/mol, XLogP of 3.79, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-diethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride is sourced from PubChem (CID 6602800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).