About 2-hexyl-1,3-dihydroisoindole;hydrobromide
2-hexyl-1,3-dihydroisoindole;hydrobromide (PubChem CID 6602811) has the molecular formula C14H22BrN
and a molecular weight of 284.24 g/mol. Its IUPAC name is 2-hexyl-1,3-dihydroisoindole;hydrobromide.
Molecular Properties
| Compound Name | 2-hexyl-1,3-dihydroisoindole;hydrobromide |
| PubChem CID | 6602811 |
| Molecular Formula | C14H22BrN |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-hexyl-1,3-dihydroisoindole;hydrobromide |
| SMILES | Br.CCCCCCN1Cc2ccccc2C1 |
| InChI | InChI=1S/C14H21N.BrH/c1-2-3-4-7-10-15-11-13-8-5-6-9-14(13)12-15;/h5-6,8-9H,2-4,7,10-12H2,1H3;1H |
| InChIKey | SCFVAEQHZSNIAI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyl-1,3-dihydroisoindole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyl-1,3-dihydroisoindole;hydrobromide?
The IUPAC name of 2-hexyl-1,3-dihydroisoindole;hydrobromide (CID 6602811) is 2-hexyl-1,3-dihydroisoindole;hydrobromide.
What is the SMILES notation for 2-hexyl-1,3-dihydroisoindole;hydrobromide?
The canonical SMILES for 2-hexyl-1,3-dihydroisoindole;hydrobromide is Br.CCCCCCN1Cc2ccccc2C1.
What is the InChIKey of 2-hexyl-1,3-dihydroisoindole;hydrobromide?
The InChIKey is SCFVAEQHZSNIAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N.BrH/c1-2-3-4-7-10-15-11-13-8-5-6-9-14(13)12-15;/h5-6,8-9H,2-4,7,10-12H2,1H3;1H.
What are the key properties of 2-hexyl-1,3-dihydroisoindole;hydrobromide?
2-hexyl-1,3-dihydroisoindole;hydrobromide has a molecular weight of 284.24 g/mol, XLogP of 4.16, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyl-1,3-dihydroisoindole;hydrobromide is sourced from PubChem (CID 6602811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).