About 2-ethyl-N-quinoxalin-6-yl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride
2-ethyl-N-quinoxalin-6-yl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride (PubChem CID 6602826) has the molecular formula C20H16ClN5O
and a molecular weight of 377.84 g/mol. Its IUPAC name is 2-ethyl-N-quinoxalin-6-yl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-ethyl-N-quinoxalin-6-yl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride |
| PubChem CID | 6602826 |
| Molecular Formula | C20H16ClN5O |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-ethyl-N-quinoxalin-6-yl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride |
| SMILES | CCc1nc(Nc2ccc3nccnc3c2)c2oc3ccccc3c2n1.Cl |
| InChI | InChI=1S/C20H15N5O.ClH/c1-2-17-24-18-13-5-3-4-6-16(13)26-19(18)20(25-17)23-12-7-8-14-15(11-12)22-10-9-21-14;/h3-11H,2H2,1H3,(H,23,24,25);1H |
| InChIKey | NFXCZNNGUPDGGW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-ethyl-N-quinoxalin-6-yl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-quinoxalin-6-yl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride?
The IUPAC name of 2-ethyl-N-quinoxalin-6-yl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride (CID 6602826) is 2-ethyl-N-quinoxalin-6-yl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride.
What is the SMILES notation for 2-ethyl-N-quinoxalin-6-yl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride?
The canonical SMILES for 2-ethyl-N-quinoxalin-6-yl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride is CCc1nc(Nc2ccc3nccnc3c2)c2oc3ccccc3c2n1.Cl.
What is the InChIKey of 2-ethyl-N-quinoxalin-6-yl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride?
The InChIKey is NFXCZNNGUPDGGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N5O.ClH/c1-2-17-24-18-13-5-3-4-6-16(13)26-19(18)20(25-17)23-12-7-8-14-15(11-12)22-10-9-21-14;/h3-11H,2H2,1H3,(H,23,24,25);1H.
What are the key properties of 2-ethyl-N-quinoxalin-6-yl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride?
2-ethyl-N-quinoxalin-6-yl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride has a molecular weight of 377.84 g/mol, XLogP of 5.05, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-quinoxalin-6-yl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride is sourced from PubChem (CID 6602826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).