About methyl 2-[(2-aminoacetyl)amino]-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride
methyl 2-[(2-aminoacetyl)amino]-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride (PubChem CID 6602836) has the molecular formula C17H26ClN3O5
and a molecular weight of 387.86 g/mol. Its IUPAC name is methyl 2-[(2-aminoacetyl)amino]-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2-[(2-aminoacetyl)amino]-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride |
| PubChem CID | 6602836 |
| Molecular Formula | C17H26ClN3O5 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | methyl 2-[(2-aminoacetyl)amino]-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride |
| SMILES | COC(=O)C(CCCCNC(=O)OCc1ccccc1)NC(=O)CN.Cl |
| InChI | InChI=1S/C17H25N3O5.ClH/c1-24-16(22)14(20-15(21)11-18)9-5-6-10-19-17(23)25-12-13-7-3-2-4-8-13;/h2-4,7-8,14H,5-6,9-12,18H2,1H3,(H,19,23)(H,20,21);1H |
| InChIKey | AWHJURCAYQYAEC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(2-aminoacetyl)amino]-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2-aminoacetyl)amino]-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride?
The IUPAC name of methyl 2-[(2-aminoacetyl)amino]-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride (CID 6602836) is methyl 2-[(2-aminoacetyl)amino]-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride.
What is the SMILES notation for methyl 2-[(2-aminoacetyl)amino]-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride?
The canonical SMILES for methyl 2-[(2-aminoacetyl)amino]-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride is COC(=O)C(CCCCNC(=O)OCc1ccccc1)NC(=O)CN.Cl.
What is the InChIKey of methyl 2-[(2-aminoacetyl)amino]-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride?
The InChIKey is AWHJURCAYQYAEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3O5.ClH/c1-24-16(22)14(20-15(21)11-18)9-5-6-10-19-17(23)25-12-13-7-3-2-4-8-13;/h2-4,7-8,14H,5-6,9-12,18H2,1H3,(H,19,23)(H,20,21);1H.
What are the key properties of methyl 2-[(2-aminoacetyl)amino]-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride?
methyl 2-[(2-aminoacetyl)amino]-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride has a molecular weight of 387.86 g/mol, XLogP of 1.12, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2-aminoacetyl)amino]-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride is sourced from PubChem (CID 6602836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).