C9H19N5O2S — CID 66028394
2-[(4-amino-3-methyl-1-propylpyrazol-5-yl)amino]ethanesulfonamide (PubChem CID 66028394) has the molecular formula C9H19N5O2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-[(4-amino-3-methyl-1-propylpyrazol-5-yl)amino]ethanesulfonamide.
| Compound Name | 2-[(4-amino-3-methyl-1-propylpyrazol-5-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 66028394 |
| Molecular Formula | C9H19N5O2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-[(4-amino-3-methyl-1-propylpyrazol-5-yl)amino]ethanesulfonamide |
| SMILES | CCCn1nc(C)c(N)c1NCCS(N)(=O)=O |
| InChI | InChI=1S/C9H19N5O2S/c1-3-5-14-9(8(10)7(2)13-14)12-4-6-17(11,15)16/h12H,3-6,10H2,1-2H3,(H2,11,15,16) |
| InChIKey | JLYUYOSXCDFORQ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |