About 4,5-dimethyl-3-oxido-2-thiophen-2-yl-1,3-oxazol-3-ium;hydrochloride
4,5-dimethyl-3-oxido-2-thiophen-2-yl-1,3-oxazol-3-ium;hydrochloride (PubChem CID 6602871) has the molecular formula C9H10ClNO2S
and a molecular weight of 231.70 g/mol. Its IUPAC name is 4,5-dimethyl-3-oxido-2-thiophen-2-yl-1,3-oxazol-3-ium;hydrochloride.
Molecular Properties
| Compound Name | 4,5-dimethyl-3-oxido-2-thiophen-2-yl-1,3-oxazol-3-ium;hydrochloride |
| PubChem CID | 6602871 |
| Molecular Formula | C9H10ClNO2S |
| Molecular Weight | 231.70 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | 4,5-dimethyl-3-oxido-2-thiophen-2-yl-1,3-oxazol-3-ium;hydrochloride |
| SMILES | Cc1oc(-c2cccs2)[n+]([O-])c1C.Cl |
| InChI | InChI=1S/C9H9NO2S.ClH/c1-6-7(2)12-9(10(6)11)8-4-3-5-13-8;/h3-5H,1-2H3;1H |
| InChIKey | CWZQNHJLLHKPRP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.70 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-3-oxido-2-thiophen-2-yl-1,3-oxazol-3-ium;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3-oxido-2-thiophen-2-yl-1,3-oxazol-3-ium;hydrochloride?
The IUPAC name of 4,5-dimethyl-3-oxido-2-thiophen-2-yl-1,3-oxazol-3-ium;hydrochloride (CID 6602871) is 4,5-dimethyl-3-oxido-2-thiophen-2-yl-1,3-oxazol-3-ium;hydrochloride.
What is the SMILES notation for 4,5-dimethyl-3-oxido-2-thiophen-2-yl-1,3-oxazol-3-ium;hydrochloride?
The canonical SMILES for 4,5-dimethyl-3-oxido-2-thiophen-2-yl-1,3-oxazol-3-ium;hydrochloride is Cc1oc(-c2cccs2)[n+]([O-])c1C.Cl.
What is the InChIKey of 4,5-dimethyl-3-oxido-2-thiophen-2-yl-1,3-oxazol-3-ium;hydrochloride?
The InChIKey is CWZQNHJLLHKPRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S.ClH/c1-6-7(2)12-9(10(6)11)8-4-3-5-13-8;/h3-5H,1-2H3;1H.
What are the key properties of 4,5-dimethyl-3-oxido-2-thiophen-2-yl-1,3-oxazol-3-ium;hydrochloride?
4,5-dimethyl-3-oxido-2-thiophen-2-yl-1,3-oxazol-3-ium;hydrochloride has a molecular weight of 231.70 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3-oxido-2-thiophen-2-yl-1,3-oxazol-3-ium;hydrochloride is sourced from PubChem (CID 6602871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).