C13H24N4O2 — CID 66029159
N-(2,3-dimethylbutyl)-3-methyl-4-nitro-1-propylpyrazol-5-amine (PubChem CID 66029159) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is N-(2,3-dimethylbutyl)-3-methyl-4-nitro-1-propylpyrazol-5-amine.
| Compound Name | N-(2,3-dimethylbutyl)-3-methyl-4-nitro-1-propylpyrazol-5-amine |
|---|---|
| PubChem CID | 66029159 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | N-(2,3-dimethylbutyl)-3-methyl-4-nitro-1-propylpyrazol-5-amine |
| SMILES | CCCn1nc(C)c([N+](=O)[O-])c1NCC(C)C(C)C |
| InChI | InChI=1S/C13H24N4O2/c1-6-7-16-13(14-8-10(4)9(2)3)12(17(18)19)11(5)15-16/h9-10,14H,6-8H2,1-5H3 |
| InChIKey | HNKMODXHIASGNG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|