About dibutyl piperidine-2,6-dicarboxylate;hydrochloride
dibutyl piperidine-2,6-dicarboxylate;hydrochloride (PubChem CID 6602935) has the molecular formula C15H28ClNO4
and a molecular weight of 321.85 g/mol. Its IUPAC name is dibutyl piperidine-2,6-dicarboxylate;hydrochloride.
Molecular Properties
| Compound Name | dibutyl piperidine-2,6-dicarboxylate;hydrochloride |
| PubChem CID | 6602935 |
| Molecular Formula | C15H28ClNO4 |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | dibutyl piperidine-2,6-dicarboxylate;hydrochloride |
| SMILES | CCCCOC(=O)C1CCCC(C(=O)OCCCC)N1.Cl |
| InChI | InChI=1S/C15H27NO4.ClH/c1-3-5-10-19-14(17)12-8-7-9-13(16-12)15(18)20-11-6-4-2;/h12-13,16H,3-11H2,1-2H3;1H |
| InChIKey | CJHGZBWAXHVVNC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dibutyl piperidine-2,6-dicarboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl piperidine-2,6-dicarboxylate;hydrochloride?
The IUPAC name of dibutyl piperidine-2,6-dicarboxylate;hydrochloride (CID 6602935) is dibutyl piperidine-2,6-dicarboxylate;hydrochloride.
What is the SMILES notation for dibutyl piperidine-2,6-dicarboxylate;hydrochloride?
The canonical SMILES for dibutyl piperidine-2,6-dicarboxylate;hydrochloride is CCCCOC(=O)C1CCCC(C(=O)OCCCC)N1.Cl.
What is the InChIKey of dibutyl piperidine-2,6-dicarboxylate;hydrochloride?
The InChIKey is CJHGZBWAXHVVNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO4.ClH/c1-3-5-10-19-14(17)12-8-7-9-13(16-12)15(18)20-11-6-4-2;/h12-13,16H,3-11H2,1-2H3;1H.
What are the key properties of dibutyl piperidine-2,6-dicarboxylate;hydrochloride?
dibutyl piperidine-2,6-dicarboxylate;hydrochloride has a molecular weight of 321.85 g/mol, XLogP of 2.61, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl piperidine-2,6-dicarboxylate;hydrochloride is sourced from PubChem (CID 6602935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).