About propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate;hydrochloride
propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate;hydrochloride (PubChem CID 6602938) has the molecular formula C24H31ClN2O5
and a molecular weight of 462.97 g/mol. Its IUPAC name is propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate;hydrochloride.
Molecular Properties
| Compound Name | propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate;hydrochloride |
| PubChem CID | 6602938 |
| Molecular Formula | C24H31ClN2O5 |
| Molecular Weight | 462.97 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate;hydrochloride |
| SMILES | CCCOC(=O)c1ccc(OCC(O)CN2CCN(C(=O)c3ccccc3)CC2)cc1.Cl |
| InChI | InChI=1S/C24H30N2O5.ClH/c1-2-16-30-24(29)20-8-10-22(11-9-20)31-18-21(27)17-25-12-14-26(15-13-25)23(28)19-6-4-3-5-7-19;/h3-11,21,27H,2,12-18H2,1H3;1H |
| InChIKey | VTHAGHFJGAJMLP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.97 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate;hydrochloride?
The IUPAC name of propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate;hydrochloride (CID 6602938) is propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate;hydrochloride.
What is the SMILES notation for propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate;hydrochloride?
The canonical SMILES for propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate;hydrochloride is CCCOC(=O)c1ccc(OCC(O)CN2CCN(C(=O)c3ccccc3)CC2)cc1.Cl.
What is the InChIKey of propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate;hydrochloride?
The InChIKey is VTHAGHFJGAJMLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O5.ClH/c1-2-16-30-24(29)20-8-10-22(11-9-20)31-18-21(27)17-25-12-14-26(15-13-25)23(28)19-6-4-3-5-7-19;/h3-11,21,27H,2,12-18H2,1H3;1H.
What are the key properties of propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate;hydrochloride?
propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate;hydrochloride has a molecular weight of 462.97 g/mol, XLogP of 2.87, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate;hydrochloride is sourced from PubChem (CID 6602938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).