About 2,2,4-trimethyl-1H-quinoline;hydrochloride
2,2,4-trimethyl-1H-quinoline;hydrochloride (PubChem CID 6602975) has the molecular formula C12H16ClN
and a molecular weight of 209.72 g/mol. Its IUPAC name is 2,2,4-trimethyl-1H-quinoline;hydrochloride.
Molecular Properties
| Compound Name | 2,2,4-trimethyl-1H-quinoline;hydrochloride |
| PubChem CID | 6602975 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2,2,4-trimethyl-1H-quinoline;hydrochloride |
| SMILES | CC1=CC(C)(C)Nc2ccccc21.Cl |
| InChI | InChI=1S/C12H15N.ClH/c1-9-8-12(2,3)13-11-7-5-4-6-10(9)11;/h4-8,13H,1-3H3;1H |
| InChIKey | NZJJOLKDAUTQAL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2,4-trimethyl-1H-quinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,4-trimethyl-1H-quinoline;hydrochloride?
The IUPAC name of 2,2,4-trimethyl-1H-quinoline;hydrochloride (CID 6602975) is 2,2,4-trimethyl-1H-quinoline;hydrochloride.
What is the SMILES notation for 2,2,4-trimethyl-1H-quinoline;hydrochloride?
The canonical SMILES for 2,2,4-trimethyl-1H-quinoline;hydrochloride is CC1=CC(C)(C)Nc2ccccc21.Cl.
What is the InChIKey of 2,2,4-trimethyl-1H-quinoline;hydrochloride?
The InChIKey is NZJJOLKDAUTQAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N.ClH/c1-9-8-12(2,3)13-11-7-5-4-6-10(9)11;/h4-8,13H,1-3H3;1H.
What are the key properties of 2,2,4-trimethyl-1H-quinoline;hydrochloride?
2,2,4-trimethyl-1H-quinoline;hydrochloride has a molecular weight of 209.72 g/mol, XLogP of 3.72, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,4-trimethyl-1H-quinoline;hydrochloride is sourced from PubChem (CID 6602975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).