About 4-(3,4-dimethoxyphenyl)-5H-pyridazino[4,3-b]indol-3-amine;hydrochloride
4-(3,4-dimethoxyphenyl)-5H-pyridazino[4,3-b]indol-3-amine;hydrochloride (PubChem CID 6602977) has the molecular formula C18H17ClN4O2
and a molecular weight of 356.81 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-5H-pyridazino[4,3-b]indol-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-(3,4-dimethoxyphenyl)-5H-pyridazino[4,3-b]indol-3-amine;hydrochloride |
| PubChem CID | 6602977 |
| Molecular Formula | C18H17ClN4O2 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-5H-pyridazino[4,3-b]indol-3-amine;hydrochloride |
| SMILES | COc1ccc(-c2c(N)nnc3c2[nH]c2ccccc23)cc1OC.Cl |
| InChI | InChI=1S/C18H16N4O2.ClH/c1-23-13-8-7-10(9-14(13)24-2)15-17-16(21-22-18(15)19)11-5-3-4-6-12(11)20-17;/h3-9,20H,1-2H3,(H2,19,22);1H |
| InChIKey | JKIBVEMUJYMLRV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3,4-dimethoxyphenyl)-5H-pyridazino[4,3-b]indol-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethoxyphenyl)-5H-pyridazino[4,3-b]indol-3-amine;hydrochloride?
The IUPAC name of 4-(3,4-dimethoxyphenyl)-5H-pyridazino[4,3-b]indol-3-amine;hydrochloride (CID 6602977) is 4-(3,4-dimethoxyphenyl)-5H-pyridazino[4,3-b]indol-3-amine;hydrochloride.
What is the SMILES notation for 4-(3,4-dimethoxyphenyl)-5H-pyridazino[4,3-b]indol-3-amine;hydrochloride?
The canonical SMILES for 4-(3,4-dimethoxyphenyl)-5H-pyridazino[4,3-b]indol-3-amine;hydrochloride is COc1ccc(-c2c(N)nnc3c2[nH]c2ccccc23)cc1OC.Cl.
What is the InChIKey of 4-(3,4-dimethoxyphenyl)-5H-pyridazino[4,3-b]indol-3-amine;hydrochloride?
The InChIKey is JKIBVEMUJYMLRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4O2.ClH/c1-23-13-8-7-10(9-14(13)24-2)15-17-16(21-22-18(15)19)11-5-3-4-6-12(11)20-17;/h3-9,20H,1-2H3,(H2,19,22);1H.
What are the key properties of 4-(3,4-dimethoxyphenyl)-5H-pyridazino[4,3-b]indol-3-amine;hydrochloride?
4-(3,4-dimethoxyphenyl)-5H-pyridazino[4,3-b]indol-3-amine;hydrochloride has a molecular weight of 356.81 g/mol, XLogP of 3.80, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethoxyphenyl)-5H-pyridazino[4,3-b]indol-3-amine;hydrochloride is sourced from PubChem (CID 6602977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).