About 4-ethynyl-1,2,6-trimethylpiperidin-4-ol;hydrochloride
4-ethynyl-1,2,6-trimethylpiperidin-4-ol;hydrochloride (PubChem CID 6603121) has the molecular formula C10H18ClNO
and a molecular weight of 203.71 g/mol. Its IUPAC name is 4-ethynyl-1,2,6-trimethylpiperidin-4-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-ethynyl-1,2,6-trimethylpiperidin-4-ol;hydrochloride |
| PubChem CID | 6603121 |
| Molecular Formula | C10H18ClNO |
| Molecular Weight | 203.71 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 4-ethynyl-1,2,6-trimethylpiperidin-4-ol;hydrochloride |
| SMILES | C#CC1(O)CC(C)N(C)C(C)C1.Cl |
| InChI | InChI=1S/C10H17NO.ClH/c1-5-10(12)6-8(2)11(4)9(3)7-10;/h1,8-9,12H,6-7H2,2-4H3;1H |
| InChIKey | XNRCBCDQVKUGSA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.71 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyl-1,2,6-trimethylpiperidin-4-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyl-1,2,6-trimethylpiperidin-4-ol;hydrochloride?
The IUPAC name of 4-ethynyl-1,2,6-trimethylpiperidin-4-ol;hydrochloride (CID 6603121) is 4-ethynyl-1,2,6-trimethylpiperidin-4-ol;hydrochloride.
What is the SMILES notation for 4-ethynyl-1,2,6-trimethylpiperidin-4-ol;hydrochloride?
The canonical SMILES for 4-ethynyl-1,2,6-trimethylpiperidin-4-ol;hydrochloride is C#CC1(O)CC(C)N(C)C(C)C1.Cl.
What is the InChIKey of 4-ethynyl-1,2,6-trimethylpiperidin-4-ol;hydrochloride?
The InChIKey is XNRCBCDQVKUGSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO.ClH/c1-5-10(12)6-8(2)11(4)9(3)7-10;/h1,8-9,12H,6-7H2,2-4H3;1H.
What are the key properties of 4-ethynyl-1,2,6-trimethylpiperidin-4-ol;hydrochloride?
4-ethynyl-1,2,6-trimethylpiperidin-4-ol;hydrochloride has a molecular weight of 203.71 g/mol, XLogP of 1.28, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyl-1,2,6-trimethylpiperidin-4-ol;hydrochloride is sourced from PubChem (CID 6603121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).