About thieno[3,2-b]thiophene-5-carboxylic acid
thieno[3,2-b]thiophene-5-carboxylic acid (PubChem CID 660319) has the molecular formula C7H4O2S2
and a molecular weight of 184.24 g/mol. Its IUPAC name is thieno[3,2-b]thiophene-5-carboxylic acid.
Molecular Properties
| Compound Name | thieno[3,2-b]thiophene-5-carboxylic acid |
| PubChem CID | 660319 |
| Molecular Formula | C7H4O2S2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 183.97 |
| IUPAC Name | thieno[3,2-b]thiophene-5-carboxylic acid |
| SMILES | O=C(O)c1cc2sccc2s1 |
| InChI | InChI=1S/C7H4O2S2/c8-7(9)6-3-5-4(11-6)1-2-10-5/h1-3H,(H,8,9) |
| InChIKey | GVZXSZWCZGKLRS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thieno[3,2-b]thiophene-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-b]thiophene-5-carboxylic acid?
The IUPAC name of thieno[3,2-b]thiophene-5-carboxylic acid (CID 660319) is thieno[3,2-b]thiophene-5-carboxylic acid.
What is the SMILES notation for thieno[3,2-b]thiophene-5-carboxylic acid?
The canonical SMILES for thieno[3,2-b]thiophene-5-carboxylic acid is O=C(O)c1cc2sccc2s1.
What is the InChIKey of thieno[3,2-b]thiophene-5-carboxylic acid?
The InChIKey is GVZXSZWCZGKLRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4O2S2/c8-7(9)6-3-5-4(11-6)1-2-10-5/h1-3H,(H,8,9).
What are the key properties of thieno[3,2-b]thiophene-5-carboxylic acid?
thieno[3,2-b]thiophene-5-carboxylic acid has a molecular weight of 184.24 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-b]thiophene-5-carboxylic acid is sourced from PubChem (CID 660319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).