thieno[3,2-b]thiophene-5-carboxylic acid

C7H4O2S2 — CID 660319

IUPACthieno[3,2-b]thiophene-5-carboxylic acid
SMILESO=C(O)c1cc2sccc2s1
InChIInChI=1S/C7H4O2S2/c8-7(9)6-3-5-4(11-6)1-2-10-5/h1-3H,(H,8,9)
InChIKeyGVZXSZWCZGKLRS-UHFFFAOYSA-N
MW184.24 g/mol
LogP2.66
Rot. Bonds1

About thieno[3,2-b]thiophene-5-carboxylic acid

thieno[3,2-b]thiophene-5-carboxylic acid (PubChem CID 660319) has the molecular formula C7H4O2S2 and a molecular weight of 184.24 g/mol. Its IUPAC name is thieno[3,2-b]thiophene-5-carboxylic acid.

Molecular Properties

Compound Namethieno[3,2-b]thiophene-5-carboxylic acid
PubChem CID660319
Molecular FormulaC7H4O2S2
Molecular Weight184.24 g/mol
Exact Mass183.97
IUPAC Namethieno[3,2-b]thiophene-5-carboxylic acid
SMILESO=C(O)c1cc2sccc2s1
InChIInChI=1S/C7H4O2S2/c8-7(9)6-3-5-4(11-6)1-2-10-5/h1-3H,(H,8,9)
InChIKeyGVZXSZWCZGKLRS-UHFFFAOYSA-N
XLogP2.66
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.24
LogP ≤ 52.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze thieno[3,2-b]thiophene-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of thieno[3,2-b]thiophene-5-carboxylic acid?
The IUPAC name of thieno[3,2-b]thiophene-5-carboxylic acid (CID 660319) is thieno[3,2-b]thiophene-5-carboxylic acid.
What is the SMILES notation for thieno[3,2-b]thiophene-5-carboxylic acid?
The canonical SMILES for thieno[3,2-b]thiophene-5-carboxylic acid is O=C(O)c1cc2sccc2s1.
What is the InChIKey of thieno[3,2-b]thiophene-5-carboxylic acid?
The InChIKey is GVZXSZWCZGKLRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4O2S2/c8-7(9)6-3-5-4(11-6)1-2-10-5/h1-3H,(H,8,9).
What are the key properties of thieno[3,2-b]thiophene-5-carboxylic acid?
thieno[3,2-b]thiophene-5-carboxylic acid has a molecular weight of 184.24 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-b]thiophene-5-carboxylic acid is sourced from PubChem (CID 660319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).