About N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N',N'-diethylethane-1,2-diamine;hydrochloride
N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N',N'-diethylethane-1,2-diamine;hydrochloride (PubChem CID 6603200) has the molecular formula C17H24Cl2N2O
and a molecular weight of 343.30 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N',N'-diethylethane-1,2-diamine;hydrochloride.
Molecular Properties
| Compound Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N',N'-diethylethane-1,2-diamine;hydrochloride |
| PubChem CID | 6603200 |
| Molecular Formula | C17H24Cl2N2O |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N',N'-diethylethane-1,2-diamine;hydrochloride |
| SMILES | CCN(CC)CCNCc1ccc(-c2ccc(Cl)cc2)o1.Cl |
| InChI | InChI=1S/C17H23ClN2O.ClH/c1-3-20(4-2)12-11-19-13-16-9-10-17(21-16)14-5-7-15(18)8-6-14;/h5-10,19H,3-4,11-13H2,1-2H3;1H |
| InChIKey | BLOWVVFAZXEVSP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N',N'-diethylethane-1,2-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N',N'-diethylethane-1,2-diamine;hydrochloride?
The IUPAC name of N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N',N'-diethylethane-1,2-diamine;hydrochloride (CID 6603200) is N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N',N'-diethylethane-1,2-diamine;hydrochloride.
What is the SMILES notation for N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N',N'-diethylethane-1,2-diamine;hydrochloride?
The canonical SMILES for N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N',N'-diethylethane-1,2-diamine;hydrochloride is CCN(CC)CCNCc1ccc(-c2ccc(Cl)cc2)o1.Cl.
What is the InChIKey of N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N',N'-diethylethane-1,2-diamine;hydrochloride?
The InChIKey is BLOWVVFAZXEVSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23ClN2O.ClH/c1-3-20(4-2)12-11-19-13-16-9-10-17(21-16)14-5-7-15(18)8-6-14;/h5-10,19H,3-4,11-13H2,1-2H3;1H.
What are the key properties of N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N',N'-diethylethane-1,2-diamine;hydrochloride?
N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N',N'-diethylethane-1,2-diamine;hydrochloride has a molecular weight of 343.30 g/mol, XLogP of 4.45, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N',N'-diethylethane-1,2-diamine;hydrochloride is sourced from PubChem (CID 6603200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).