About 1-morpholin-4-yl-2-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylethanone;hydrochloride
1-morpholin-4-yl-2-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylethanone;hydrochloride (PubChem CID 6603210) has the molecular formula C19H25ClN2O2
and a molecular weight of 348.87 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylethanone;hydrochloride.
Molecular Properties
| Compound Name | 1-morpholin-4-yl-2-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylethanone;hydrochloride |
| PubChem CID | 6603210 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-morpholin-4-yl-2-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylethanone;hydrochloride |
| SMILES | Cl.O=C(CC1=NC2(CCCC2)Cc2ccccc21)N1CCOCC1 |
| InChI | InChI=1S/C19H24N2O2.ClH/c22-18(21-9-11-23-12-10-21)13-17-16-6-2-1-5-15(16)14-19(20-17)7-3-4-8-19;/h1-2,5-6H,3-4,7-14H2;1H |
| InChIKey | QFLFDNCMIIWLSC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-morpholin-4-yl-2-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-yl-2-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylethanone;hydrochloride?
The IUPAC name of 1-morpholin-4-yl-2-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylethanone;hydrochloride (CID 6603210) is 1-morpholin-4-yl-2-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylethanone;hydrochloride.
What is the SMILES notation for 1-morpholin-4-yl-2-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylethanone;hydrochloride?
The canonical SMILES for 1-morpholin-4-yl-2-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylethanone;hydrochloride is Cl.O=C(CC1=NC2(CCCC2)Cc2ccccc21)N1CCOCC1.
What is the InChIKey of 1-morpholin-4-yl-2-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylethanone;hydrochloride?
The InChIKey is QFLFDNCMIIWLSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O2.ClH/c22-18(21-9-11-23-12-10-21)13-17-16-6-2-1-5-15(16)14-19(20-17)7-3-4-8-19;/h1-2,5-6H,3-4,7-14H2;1H.
What are the key properties of 1-morpholin-4-yl-2-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylethanone;hydrochloride?
1-morpholin-4-yl-2-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylethanone;hydrochloride has a molecular weight of 348.87 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-yl-2-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylethanone;hydrochloride is sourced from PubChem (CID 6603210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).