About 1-(2-hydroxyethyl)-4,6-dimethylpyrimidin-2-one;hydrochloride
1-(2-hydroxyethyl)-4,6-dimethylpyrimidin-2-one;hydrochloride (PubChem CID 6603213) has the molecular formula C8H13ClN2O2
and a molecular weight of 204.66 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-4,6-dimethylpyrimidin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1-(2-hydroxyethyl)-4,6-dimethylpyrimidin-2-one;hydrochloride |
| PubChem CID | 6603213 |
| Molecular Formula | C8H13ClN2O2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 1-(2-hydroxyethyl)-4,6-dimethylpyrimidin-2-one;hydrochloride |
| SMILES | Cc1cc(C)n(CCO)c(=O)n1.Cl |
| InChI | InChI=1S/C8H12N2O2.ClH/c1-6-5-7(2)10(3-4-11)8(12)9-6;/h5,11H,3-4H2,1-2H3;1H |
| InChIKey | GGKYJCIZGRQFNI-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-hydroxyethyl)-4,6-dimethylpyrimidin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxyethyl)-4,6-dimethylpyrimidin-2-one;hydrochloride?
The IUPAC name of 1-(2-hydroxyethyl)-4,6-dimethylpyrimidin-2-one;hydrochloride (CID 6603213) is 1-(2-hydroxyethyl)-4,6-dimethylpyrimidin-2-one;hydrochloride.
What is the SMILES notation for 1-(2-hydroxyethyl)-4,6-dimethylpyrimidin-2-one;hydrochloride?
The canonical SMILES for 1-(2-hydroxyethyl)-4,6-dimethylpyrimidin-2-one;hydrochloride is Cc1cc(C)n(CCO)c(=O)n1.Cl.
What is the InChIKey of 1-(2-hydroxyethyl)-4,6-dimethylpyrimidin-2-one;hydrochloride?
The InChIKey is GGKYJCIZGRQFNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2.ClH/c1-6-5-7(2)10(3-4-11)8(12)9-6;/h5,11H,3-4H2,1-2H3;1H.
What are the key properties of 1-(2-hydroxyethyl)-4,6-dimethylpyrimidin-2-one;hydrochloride?
1-(2-hydroxyethyl)-4,6-dimethylpyrimidin-2-one;hydrochloride has a molecular weight of 204.66 g/mol, XLogP of 0.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyethyl)-4,6-dimethylpyrimidin-2-one;hydrochloride is sourced from PubChem (CID 6603213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).