About 2-(dimethylamino)ethyl 1-benzylindole-3-carboxylate;hydrochloride
2-(dimethylamino)ethyl 1-benzylindole-3-carboxylate;hydrochloride (PubChem CID 6603257) has the molecular formula C20H23ClN2O2
and a molecular weight of 358.87 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 1-benzylindole-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 1-benzylindole-3-carboxylate;hydrochloride |
| PubChem CID | 6603257 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-(dimethylamino)ethyl 1-benzylindole-3-carboxylate;hydrochloride |
| SMILES | CN(C)CCOC(=O)c1cn(Cc2ccccc2)c2ccccc12.Cl |
| InChI | InChI=1S/C20H22N2O2.ClH/c1-21(2)12-13-24-20(23)18-15-22(14-16-8-4-3-5-9-16)19-11-7-6-10-17(18)19;/h3-11,15H,12-14H2,1-2H3;1H |
| InChIKey | CNMZAVGTJMZVEL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(dimethylamino)ethyl 1-benzylindole-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 1-benzylindole-3-carboxylate;hydrochloride?
The IUPAC name of 2-(dimethylamino)ethyl 1-benzylindole-3-carboxylate;hydrochloride (CID 6603257) is 2-(dimethylamino)ethyl 1-benzylindole-3-carboxylate;hydrochloride.
What is the SMILES notation for 2-(dimethylamino)ethyl 1-benzylindole-3-carboxylate;hydrochloride?
The canonical SMILES for 2-(dimethylamino)ethyl 1-benzylindole-3-carboxylate;hydrochloride is CN(C)CCOC(=O)c1cn(Cc2ccccc2)c2ccccc12.Cl.
What is the InChIKey of 2-(dimethylamino)ethyl 1-benzylindole-3-carboxylate;hydrochloride?
The InChIKey is CNMZAVGTJMZVEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O2.ClH/c1-21(2)12-13-24-20(23)18-15-22(14-16-8-4-3-5-9-16)19-11-7-6-10-17(18)19;/h3-11,15H,12-14H2,1-2H3;1H.
What are the key properties of 2-(dimethylamino)ethyl 1-benzylindole-3-carboxylate;hydrochloride?
2-(dimethylamino)ethyl 1-benzylindole-3-carboxylate;hydrochloride has a molecular weight of 358.87 g/mol, XLogP of 3.83, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 1-benzylindole-3-carboxylate;hydrochloride is sourced from PubChem (CID 6603257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).