About N-(2,3-dimethylcyclohexyl)-2-(1-methylimidazol-2-yl)sulfanylacetamide;hydrochloride
N-(2,3-dimethylcyclohexyl)-2-(1-methylimidazol-2-yl)sulfanylacetamide;hydrochloride (PubChem CID 6603260) has the molecular formula C14H24ClN3OS
and a molecular weight of 317.89 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-2-(1-methylimidazol-2-yl)sulfanylacetamide;hydrochloride.
Molecular Properties
| Compound Name | N-(2,3-dimethylcyclohexyl)-2-(1-methylimidazol-2-yl)sulfanylacetamide;hydrochloride |
| PubChem CID | 6603260 |
| Molecular Formula | C14H24ClN3OS |
| Molecular Weight | 317.89 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-2-(1-methylimidazol-2-yl)sulfanylacetamide;hydrochloride |
| SMILES | CC1CCCC(NC(=O)CSc2nccn2C)C1C.Cl |
| InChI | InChI=1S/C14H23N3OS.ClH/c1-10-5-4-6-12(11(10)2)16-13(18)9-19-14-15-7-8-17(14)3;/h7-8,10-12H,4-6,9H2,1-3H3,(H,16,18);1H |
| InChIKey | YFJYRAUCYYFFPX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.89 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,3-dimethylcyclohexyl)-2-(1-methylimidazol-2-yl)sulfanylacetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dimethylcyclohexyl)-2-(1-methylimidazol-2-yl)sulfanylacetamide;hydrochloride?
The IUPAC name of N-(2,3-dimethylcyclohexyl)-2-(1-methylimidazol-2-yl)sulfanylacetamide;hydrochloride (CID 6603260) is N-(2,3-dimethylcyclohexyl)-2-(1-methylimidazol-2-yl)sulfanylacetamide;hydrochloride.
What is the SMILES notation for N-(2,3-dimethylcyclohexyl)-2-(1-methylimidazol-2-yl)sulfanylacetamide;hydrochloride?
The canonical SMILES for N-(2,3-dimethylcyclohexyl)-2-(1-methylimidazol-2-yl)sulfanylacetamide;hydrochloride is CC1CCCC(NC(=O)CSc2nccn2C)C1C.Cl.
What is the InChIKey of N-(2,3-dimethylcyclohexyl)-2-(1-methylimidazol-2-yl)sulfanylacetamide;hydrochloride?
The InChIKey is YFJYRAUCYYFFPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3OS.ClH/c1-10-5-4-6-12(11(10)2)16-13(18)9-19-14-15-7-8-17(14)3;/h7-8,10-12H,4-6,9H2,1-3H3,(H,16,18);1H.
What are the key properties of N-(2,3-dimethylcyclohexyl)-2-(1-methylimidazol-2-yl)sulfanylacetamide;hydrochloride?
N-(2,3-dimethylcyclohexyl)-2-(1-methylimidazol-2-yl)sulfanylacetamide;hydrochloride has a molecular weight of 317.89 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dimethylcyclohexyl)-2-(1-methylimidazol-2-yl)sulfanylacetamide;hydrochloride is sourced from PubChem (CID 6603260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).