About 5-bromo-N-(4,6-dimethyl-2-pyridinyl)thiophene-2-sulfonamide;hydrochloride
5-bromo-N-(4,6-dimethyl-2-pyridinyl)thiophene-2-sulfonamide;hydrochloride (PubChem CID 6603298) has the molecular formula C11H12BrClN2O2S2
and a molecular weight of 383.72 g/mol. Its IUPAC name is 5-bromo-N-(4,6-dimethyl-2-pyridinyl)thiophene-2-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | 5-bromo-N-(4,6-dimethyl-2-pyridinyl)thiophene-2-sulfonamide;hydrochloride |
| PubChem CID | 6603298 |
| Molecular Formula | C11H12BrClN2O2S2 |
| Molecular Weight | 383.72 g/mol |
| Exact Mass | 381.92 |
| IUPAC Name | 5-bromo-N-(4,6-dimethyl-2-pyridinyl)thiophene-2-sulfonamide;hydrochloride |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(Br)s2)c1.Cl |
| InChI | InChI=1S/C11H11BrN2O2S2.ClH/c1-7-5-8(2)13-10(6-7)14-18(15,16)11-4-3-9(12)17-11;/h3-6H,1-2H3,(H,13,14);1H |
| InChIKey | BLYCPMUITLGTQE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.72 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-N-(4,6-dimethyl-2-pyridinyl)thiophene-2-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(4,6-dimethyl-2-pyridinyl)thiophene-2-sulfonamide;hydrochloride?
The IUPAC name of 5-bromo-N-(4,6-dimethyl-2-pyridinyl)thiophene-2-sulfonamide;hydrochloride (CID 6603298) is 5-bromo-N-(4,6-dimethyl-2-pyridinyl)thiophene-2-sulfonamide;hydrochloride.
What is the SMILES notation for 5-bromo-N-(4,6-dimethyl-2-pyridinyl)thiophene-2-sulfonamide;hydrochloride?
The canonical SMILES for 5-bromo-N-(4,6-dimethyl-2-pyridinyl)thiophene-2-sulfonamide;hydrochloride is Cc1cc(C)nc(NS(=O)(=O)c2ccc(Br)s2)c1.Cl.
What is the InChIKey of 5-bromo-N-(4,6-dimethyl-2-pyridinyl)thiophene-2-sulfonamide;hydrochloride?
The InChIKey is BLYCPMUITLGTQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrN2O2S2.ClH/c1-7-5-8(2)13-10(6-7)14-18(15,16)11-4-3-9(12)17-11;/h3-6H,1-2H3,(H,13,14);1H.
What are the key properties of 5-bromo-N-(4,6-dimethyl-2-pyridinyl)thiophene-2-sulfonamide;hydrochloride?
5-bromo-N-(4,6-dimethyl-2-pyridinyl)thiophene-2-sulfonamide;hydrochloride has a molecular weight of 383.72 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(4,6-dimethyl-2-pyridinyl)thiophene-2-sulfonamide;hydrochloride is sourced from PubChem (CID 6603298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).