About 1,3-thiazole-4-carboxylic acid;hydrobromide
1,3-thiazole-4-carboxylic acid;hydrobromide (PubChem CID 6603305) has the molecular formula C4H4BrNO2S
and a molecular weight of 210.05 g/mol. Its IUPAC name is 1,3-thiazole-4-carboxylic acid;hydrobromide.
Molecular Properties
| Compound Name | 1,3-thiazole-4-carboxylic acid;hydrobromide |
| PubChem CID | 6603305 |
| Molecular Formula | C4H4BrNO2S |
| Molecular Weight | 210.05 g/mol |
| Exact Mass | 208.91 |
| IUPAC Name | 1,3-thiazole-4-carboxylic acid;hydrobromide |
| SMILES | Br.O=C(O)c1cscn1 |
| InChI | InChI=1S/C4H3NO2S.BrH/c6-4(7)3-1-8-2-5-3;/h1-2H,(H,6,7);1H |
| InChIKey | PTPAIKFTQURKHP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.05 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-thiazole-4-carboxylic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazole-4-carboxylic acid;hydrobromide?
The IUPAC name of 1,3-thiazole-4-carboxylic acid;hydrobromide (CID 6603305) is 1,3-thiazole-4-carboxylic acid;hydrobromide.
What is the SMILES notation for 1,3-thiazole-4-carboxylic acid;hydrobromide?
The canonical SMILES for 1,3-thiazole-4-carboxylic acid;hydrobromide is Br.O=C(O)c1cscn1.
What is the InChIKey of 1,3-thiazole-4-carboxylic acid;hydrobromide?
The InChIKey is PTPAIKFTQURKHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2S.BrH/c6-4(7)3-1-8-2-5-3;/h1-2H,(H,6,7);1H.
What are the key properties of 1,3-thiazole-4-carboxylic acid;hydrobromide?
1,3-thiazole-4-carboxylic acid;hydrobromide has a molecular weight of 210.05 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazole-4-carboxylic acid;hydrobromide is sourced from PubChem (CID 6603305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).