C9H16N2O3 — CID 66033141
3-(2-aminopropanoylamino)cyclopentane-1-carboxylic acid (PubChem CID 66033141) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-(2-aminopropanoylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(2-aminopropanoylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 66033141 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 3-(2-aminopropanoylamino)cyclopentane-1-carboxylic acid |
| SMILES | CC(N)C(=O)NC1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C9H16N2O3/c1-5(10)8(12)11-7-3-2-6(4-7)9(13)14/h5-7H,2-4,10H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | NONSZBWHPWIQEL-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |