About 1-(4-bromophenyl)-2-(1,2-dihydroimidazo[1,2-a]benzimidazol-4-yl)ethanone;hydrobromide
1-(4-bromophenyl)-2-(1,2-dihydroimidazo[1,2-a]benzimidazol-4-yl)ethanone;hydrobromide (PubChem CID 6603329) has the molecular formula C17H15Br2N3O
and a molecular weight of 437.14 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(1,2-dihydroimidazo[1,2-a]benzimidazol-4-yl)ethanone;hydrobromide.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-2-(1,2-dihydroimidazo[1,2-a]benzimidazol-4-yl)ethanone;hydrobromide |
| PubChem CID | 6603329 |
| Molecular Formula | C17H15Br2N3O |
| Molecular Weight | 437.14 g/mol |
| Exact Mass | 434.96 |
| IUPAC Name | 1-(4-bromophenyl)-2-(1,2-dihydroimidazo[1,2-a]benzimidazol-4-yl)ethanone;hydrobromide |
| SMILES | Br.O=C(CN1C2=NCCN2c2ccccc21)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H14BrN3O.BrH/c18-13-7-5-12(6-8-13)16(22)11-21-15-4-2-1-3-14(15)20-10-9-19-17(20)21;/h1-8H,9-11H2;1H |
| InChIKey | PFQJYBRTHOCHNW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.14 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-bromophenyl)-2-(1,2-dihydroimidazo[1,2-a]benzimidazol-4-yl)ethanone;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-2-(1,2-dihydroimidazo[1,2-a]benzimidazol-4-yl)ethanone;hydrobromide?
The IUPAC name of 1-(4-bromophenyl)-2-(1,2-dihydroimidazo[1,2-a]benzimidazol-4-yl)ethanone;hydrobromide (CID 6603329) is 1-(4-bromophenyl)-2-(1,2-dihydroimidazo[1,2-a]benzimidazol-4-yl)ethanone;hydrobromide.
What is the SMILES notation for 1-(4-bromophenyl)-2-(1,2-dihydroimidazo[1,2-a]benzimidazol-4-yl)ethanone;hydrobromide?
The canonical SMILES for 1-(4-bromophenyl)-2-(1,2-dihydroimidazo[1,2-a]benzimidazol-4-yl)ethanone;hydrobromide is Br.O=C(CN1C2=NCCN2c2ccccc21)c1ccc(Br)cc1.
What is the InChIKey of 1-(4-bromophenyl)-2-(1,2-dihydroimidazo[1,2-a]benzimidazol-4-yl)ethanone;hydrobromide?
The InChIKey is PFQJYBRTHOCHNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrN3O.BrH/c18-13-7-5-12(6-8-13)16(22)11-21-15-4-2-1-3-14(15)20-10-9-19-17(20)21;/h1-8H,9-11H2;1H.
What are the key properties of 1-(4-bromophenyl)-2-(1,2-dihydroimidazo[1,2-a]benzimidazol-4-yl)ethanone;hydrobromide?
1-(4-bromophenyl)-2-(1,2-dihydroimidazo[1,2-a]benzimidazol-4-yl)ethanone;hydrobromide has a molecular weight of 437.14 g/mol, XLogP of 3.91, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-2-(1,2-dihydroimidazo[1,2-a]benzimidazol-4-yl)ethanone;hydrobromide is sourced from PubChem (CID 6603329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).