About 4-(2-methyl-1,3-thiazol-4-yl)benzoic acid;hydrobromide
4-(2-methyl-1,3-thiazol-4-yl)benzoic acid;hydrobromide (PubChem CID 6603383) has the molecular formula C11H10BrNO2S
and a molecular weight of 300.18 g/mol. Its IUPAC name is 4-(2-methyl-1,3-thiazol-4-yl)benzoic acid;hydrobromide.
Molecular Properties
| Compound Name | 4-(2-methyl-1,3-thiazol-4-yl)benzoic acid;hydrobromide |
| PubChem CID | 6603383 |
| Molecular Formula | C11H10BrNO2S |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 298.96 |
| IUPAC Name | 4-(2-methyl-1,3-thiazol-4-yl)benzoic acid;hydrobromide |
| SMILES | Br.Cc1nc(-c2ccc(C(=O)O)cc2)cs1 |
| InChI | InChI=1S/C11H9NO2S.BrH/c1-7-12-10(6-15-7)8-2-4-9(5-3-8)11(13)14;/h2-6H,1H3,(H,13,14);1H |
| InChIKey | JXQSRFQWSFCQIF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-methyl-1,3-thiazol-4-yl)benzoic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-1,3-thiazol-4-yl)benzoic acid;hydrobromide?
The IUPAC name of 4-(2-methyl-1,3-thiazol-4-yl)benzoic acid;hydrobromide (CID 6603383) is 4-(2-methyl-1,3-thiazol-4-yl)benzoic acid;hydrobromide.
What is the SMILES notation for 4-(2-methyl-1,3-thiazol-4-yl)benzoic acid;hydrobromide?
The canonical SMILES for 4-(2-methyl-1,3-thiazol-4-yl)benzoic acid;hydrobromide is Br.Cc1nc(-c2ccc(C(=O)O)cc2)cs1.
What is the InChIKey of 4-(2-methyl-1,3-thiazol-4-yl)benzoic acid;hydrobromide?
The InChIKey is JXQSRFQWSFCQIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2S.BrH/c1-7-12-10(6-15-7)8-2-4-9(5-3-8)11(13)14;/h2-6H,1H3,(H,13,14);1H.
What are the key properties of 4-(2-methyl-1,3-thiazol-4-yl)benzoic acid;hydrobromide?
4-(2-methyl-1,3-thiazol-4-yl)benzoic acid;hydrobromide has a molecular weight of 300.18 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-1,3-thiazol-4-yl)benzoic acid;hydrobromide is sourced from PubChem (CID 6603383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).