C17H22ClN3 — CID 66033861
5-[[1-(chloromethyl)-3,4-dihydro-2H-naphthalen-1-yl]methyl]-1-propan-2-yl-1,2,4-triazole (PubChem CID 66033861) has the molecular formula C17H22ClN3 and a molecular weight of 303.84 g/mol. Its IUPAC name is 5-[[1-(chloromethyl)-3,4-dihydro-2H-naphthalen-1-yl]methyl]-1-propan-2-yl-1,2,4-triazole.
| Compound Name | 5-[[1-(chloromethyl)-3,4-dihydro-2H-naphthalen-1-yl]methyl]-1-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 66033861 |
| Molecular Formula | C17H22ClN3 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 5-[[1-(chloromethyl)-3,4-dihydro-2H-naphthalen-1-yl]methyl]-1-propan-2-yl-1,2,4-triazole |
| SMILES | CC(C)n1ncnc1CC1(CCl)CCCc2ccccc21 |
| InChI | InChI=1S/C17H22ClN3/c1-13(2)21-16(19-12-20-21)10-17(11-18)9-5-7-14-6-3-4-8-15(14)17/h3-4,6,8,12-13H,5,7,9-11H2,1-2H3 |
| InChIKey | FZVKULVWGSEUGW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|