About 5-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride
5-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride (PubChem CID 6603411) has the molecular formula C14H19Cl2N3OS
and a molecular weight of 348.30 g/mol. Its IUPAC name is 5-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride |
| PubChem CID | 6603411 |
| Molecular Formula | C14H19Cl2N3OS |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 5-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride |
| SMILES | Cl.NCCCCCc1nnc(SCc2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C14H18ClN3OS.ClH/c15-12-6-4-5-11(9-12)10-20-14-18-17-13(19-14)7-2-1-3-8-16;/h4-6,9H,1-3,7-8,10,16H2;1H |
| InChIKey | RPFLTORNEPUQRK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride?
The IUPAC name of 5-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride (CID 6603411) is 5-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride.
What is the SMILES notation for 5-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride?
The canonical SMILES for 5-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride is Cl.NCCCCCc1nnc(SCc2cccc(Cl)c2)o1.
What is the InChIKey of 5-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride?
The InChIKey is RPFLTORNEPUQRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClN3OS.ClH/c15-12-6-4-5-11(9-12)10-20-14-18-17-13(19-14)7-2-1-3-8-16;/h4-6,9H,1-3,7-8,10,16H2;1H.
What are the key properties of 5-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride?
5-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride has a molecular weight of 348.30 g/mol, XLogP of 4.11, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[(3-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride is sourced from PubChem (CID 6603411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).