C12H13ClF2O — CID 66034129
3-(chloromethyl)-3-[(2,5-difluorophenyl)methyl]oxolane (PubChem CID 66034129) has the molecular formula C12H13ClF2O and a molecular weight of 246.68 g/mol. Its IUPAC name is 3-(chloromethyl)-3-[(2,5-difluorophenyl)methyl]oxolane.
| Compound Name | 3-(chloromethyl)-3-[(2,5-difluorophenyl)methyl]oxolane |
|---|---|
| PubChem CID | 66034129 |
| Molecular Formula | C12H13ClF2O |
| Molecular Weight | 246.68 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 3-(chloromethyl)-3-[(2,5-difluorophenyl)methyl]oxolane |
| SMILES | Fc1ccc(F)c(CC2(CCl)CCOC2)c1 |
| InChI | InChI=1S/C12H13ClF2O/c13-7-12(3-4-16-8-12)6-9-5-10(14)1-2-11(9)15/h1-2,5H,3-4,6-8H2 |
| InChIKey | VPUFUMFGDNPLNA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.68 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|