About (1-morpholin-4-yl-3-phenylmethoxypropan-2-yl) 2-phenylacetate;hydrochloride
(1-morpholin-4-yl-3-phenylmethoxypropan-2-yl) 2-phenylacetate;hydrochloride (PubChem CID 6603439) has the molecular formula C22H28ClNO4
and a molecular weight of 405.92 g/mol. Its IUPAC name is (1-morpholin-4-yl-3-phenylmethoxypropan-2-yl) 2-phenylacetate;hydrochloride.
Molecular Properties
| Compound Name | (1-morpholin-4-yl-3-phenylmethoxypropan-2-yl) 2-phenylacetate;hydrochloride |
| PubChem CID | 6603439 |
| Molecular Formula | C22H28ClNO4 |
| Molecular Weight | 405.92 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (1-morpholin-4-yl-3-phenylmethoxypropan-2-yl) 2-phenylacetate;hydrochloride |
| SMILES | Cl.O=C(Cc1ccccc1)OC(COCc1ccccc1)CN1CCOCC1 |
| InChI | InChI=1S/C22H27NO4.ClH/c24-22(15-19-7-3-1-4-8-19)27-21(16-23-11-13-25-14-12-23)18-26-17-20-9-5-2-6-10-20;/h1-10,21H,11-18H2;1H |
| InChIKey | AWWRAGUSFBQDFZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.92 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-morpholin-4-yl-3-phenylmethoxypropan-2-yl) 2-phenylacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-morpholin-4-yl-3-phenylmethoxypropan-2-yl) 2-phenylacetate;hydrochloride?
The IUPAC name of (1-morpholin-4-yl-3-phenylmethoxypropan-2-yl) 2-phenylacetate;hydrochloride (CID 6603439) is (1-morpholin-4-yl-3-phenylmethoxypropan-2-yl) 2-phenylacetate;hydrochloride.
What is the SMILES notation for (1-morpholin-4-yl-3-phenylmethoxypropan-2-yl) 2-phenylacetate;hydrochloride?
The canonical SMILES for (1-morpholin-4-yl-3-phenylmethoxypropan-2-yl) 2-phenylacetate;hydrochloride is Cl.O=C(Cc1ccccc1)OC(COCc1ccccc1)CN1CCOCC1.
What is the InChIKey of (1-morpholin-4-yl-3-phenylmethoxypropan-2-yl) 2-phenylacetate;hydrochloride?
The InChIKey is AWWRAGUSFBQDFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO4.ClH/c24-22(15-19-7-3-1-4-8-19)27-21(16-23-11-13-25-14-12-23)18-26-17-20-9-5-2-6-10-20;/h1-10,21H,11-18H2;1H.
What are the key properties of (1-morpholin-4-yl-3-phenylmethoxypropan-2-yl) 2-phenylacetate;hydrochloride?
(1-morpholin-4-yl-3-phenylmethoxypropan-2-yl) 2-phenylacetate;hydrochloride has a molecular weight of 405.92 g/mol, XLogP of 3.11, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-morpholin-4-yl-3-phenylmethoxypropan-2-yl) 2-phenylacetate;hydrochloride is sourced from PubChem (CID 6603439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).