C16H25ClN6O — CID 6603445
1-cyclopentyl-4-[[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]piperazine;hydrochloride (PubChem CID 6603445) has the molecular formula C16H25ClN6O and a molecular weight of 352.87 g/mol. Its IUPAC name is 1-cyclopentyl-4-[[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]piperazine;hydrochloride.
| Compound Name | 1-cyclopentyl-4-[[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 6603445 |
| Molecular Formula | C16H25ClN6O |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-cyclopentyl-4-[[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]piperazine;hydrochloride |
| SMILES | Cl.c1coc(Cn2nnnc2CN2CCN(C3CCCC3)CC2)c1 |
| InChI | InChI=1S/C16H24N6O.ClH/c1-2-5-14(4-1)21-9-7-20(8-10-21)13-16-17-18-19-22(16)12-15-6-3-11-23-15;/h3,6,11,14H,1-2,4-5,7-10,12-13H2;1H |
| InChIKey | WJOLYNPEYCWJAP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |