C15H18ClF3O — CID 66034531
4-(chloromethyl)-4-[2-(2,2,2-trifluoroethoxy)ethyl]-2,3-dihydro-1H-naphthalene (PubChem CID 66034531) has the molecular formula C15H18ClF3O and a molecular weight of 306.75 g/mol. Its IUPAC name is 4-(chloromethyl)-4-[2-(2,2,2-trifluoroethoxy)ethyl]-2,3-dihydro-1H-naphthalene.
| Compound Name | 4-(chloromethyl)-4-[2-(2,2,2-trifluoroethoxy)ethyl]-2,3-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 66034531 |
| Molecular Formula | C15H18ClF3O |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-(chloromethyl)-4-[2-(2,2,2-trifluoroethoxy)ethyl]-2,3-dihydro-1H-naphthalene |
| SMILES | FC(F)(F)COCCC1(CCl)CCCc2ccccc21 |
| InChI | InChI=1S/C15H18ClF3O/c16-10-14(8-9-20-11-15(17,18)19)7-3-5-12-4-1-2-6-13(12)14/h1-2,4,6H,3,5,7-11H2 |
| InChIKey | DTEPHBVZGONPBD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|