About 5-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride
5-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride (PubChem CID 6603472) has the molecular formula C16H22ClN3OS
and a molecular weight of 339.89 g/mol. Its IUPAC name is 5-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride |
| PubChem CID | 6603472 |
| Molecular Formula | C16H22ClN3OS |
| Molecular Weight | 339.89 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 5-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride |
| SMILES | Cl.NCCCCCc1nnc(SC/C=C/c2ccccc2)o1 |
| InChI | InChI=1S/C16H21N3OS.ClH/c17-12-6-2-5-11-15-18-19-16(20-15)21-13-7-10-14-8-3-1-4-9-14;/h1,3-4,7-10H,2,5-6,11-13,17H2;1H/b10-7+; |
| InChIKey | OULRNRNXSNSERG-HCUGZAAXSA-N |
| XLogP | 3.97 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.89 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride?
The IUPAC name of 5-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride (CID 6603472) is 5-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride.
What is the SMILES notation for 5-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride?
The canonical SMILES for 5-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride is Cl.NCCCCCc1nnc(SC/C=C/c2ccccc2)o1.
What is the InChIKey of 5-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride?
The InChIKey is OULRNRNXSNSERG-HCUGZAAXSA-N. The full InChI is InChI=1S/C16H21N3OS.ClH/c17-12-6-2-5-11-15-18-19-16(20-15)21-13-7-10-14-8-3-1-4-9-14;/h1,3-4,7-10H,2,5-6,11-13,17H2;1H/b10-7+;.
What are the key properties of 5-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride?
5-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride has a molecular weight of 339.89 g/mol, XLogP of 3.97, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentan-1-amine;hydrochloride is sourced from PubChem (CID 6603472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).