About 1-(3-butyl-2-iminobenzimidazol-1-yl)-3,3-dimethylbutan-2-one;hydrobromide
1-(3-butyl-2-iminobenzimidazol-1-yl)-3,3-dimethylbutan-2-one;hydrobromide (PubChem CID 6603487) has the molecular formula C17H26BrN3O
and a molecular weight of 368.32 g/mol. Its IUPAC name is 1-(3-butyl-2-iminobenzimidazol-1-yl)-3,3-dimethylbutan-2-one;hydrobromide.
Molecular Properties
| Compound Name | 1-(3-butyl-2-iminobenzimidazol-1-yl)-3,3-dimethylbutan-2-one;hydrobromide |
| PubChem CID | 6603487 |
| Molecular Formula | C17H26BrN3O |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-(3-butyl-2-iminobenzimidazol-1-yl)-3,3-dimethylbutan-2-one;hydrobromide |
| SMILES | Br.[H]/N=c1\n(CCCC)c2ccccc2n1CC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H25N3O.BrH/c1-5-6-11-19-13-9-7-8-10-14(13)20(16(19)18)12-15(21)17(2,3)4;/h7-10,18H,5-6,11-12H2,1-4H3;1H/b18-16+; |
| InChIKey | HMMAKYFNGAIMGF-HYNBPGMHSA-N |
| XLogP | 3.92 |
| TPSA | 50.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-butyl-2-iminobenzimidazol-1-yl)-3,3-dimethylbutan-2-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-butyl-2-iminobenzimidazol-1-yl)-3,3-dimethylbutan-2-one;hydrobromide?
The IUPAC name of 1-(3-butyl-2-iminobenzimidazol-1-yl)-3,3-dimethylbutan-2-one;hydrobromide (CID 6603487) is 1-(3-butyl-2-iminobenzimidazol-1-yl)-3,3-dimethylbutan-2-one;hydrobromide.
What is the SMILES notation for 1-(3-butyl-2-iminobenzimidazol-1-yl)-3,3-dimethylbutan-2-one;hydrobromide?
The canonical SMILES for 1-(3-butyl-2-iminobenzimidazol-1-yl)-3,3-dimethylbutan-2-one;hydrobromide is Br.[H]/N=c1\n(CCCC)c2ccccc2n1CC(=O)C(C)(C)C.
What is the InChIKey of 1-(3-butyl-2-iminobenzimidazol-1-yl)-3,3-dimethylbutan-2-one;hydrobromide?
The InChIKey is HMMAKYFNGAIMGF-HYNBPGMHSA-N. The full InChI is InChI=1S/C17H25N3O.BrH/c1-5-6-11-19-13-9-7-8-10-14(13)20(16(19)18)12-15(21)17(2,3)4;/h7-10,18H,5-6,11-12H2,1-4H3;1H/b18-16+;.
What are the key properties of 1-(3-butyl-2-iminobenzimidazol-1-yl)-3,3-dimethylbutan-2-one;hydrobromide?
1-(3-butyl-2-iminobenzimidazol-1-yl)-3,3-dimethylbutan-2-one;hydrobromide has a molecular weight of 368.32 g/mol, XLogP of 3.92, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-butyl-2-iminobenzimidazol-1-yl)-3,3-dimethylbutan-2-one;hydrobromide is sourced from PubChem (CID 6603487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).