C12H14BrN3O3S — CID 6603507
2-[(2,2-diamino-1,3-oxathiolan-5-yl)methyl]isoindole-1,3-dione;hydrobromide (PubChem CID 6603507) has the molecular formula C12H14BrN3O3S and a molecular weight of 360.23 g/mol. Its IUPAC name is 2-[(2,2-diamino-1,3-oxathiolan-5-yl)methyl]isoindole-1,3-dione;hydrobromide.
| Compound Name | 2-[(2,2-diamino-1,3-oxathiolan-5-yl)methyl]isoindole-1,3-dione;hydrobromide |
|---|---|
| PubChem CID | 6603507 |
| Molecular Formula | C12H14BrN3O3S |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 2-[(2,2-diamino-1,3-oxathiolan-5-yl)methyl]isoindole-1,3-dione;hydrobromide |
| SMILES | Br.NC1(N)OC(CN2C(=O)c3ccccc3C2=O)CS1 |
| InChI | InChI=1S/C12H13N3O3S.BrH/c13-12(14)18-7(6-19-12)5-15-10(16)8-3-1-2-4-9(8)11(15)17;/h1-4,7H,5-6,13-14H2;1H |
| InChIKey | NBWQMQKIDAWOIC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|