C19H21Cl3N2 — CID 6603513
4-[(2,4-dichlorophenyl)methyl]-2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-imine;hydrochloride (PubChem CID 6603513) has the molecular formula C19H21Cl3N2 and a molecular weight of 383.75 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methyl]-2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-imine;hydrochloride.
| Compound Name | 4-[(2,4-dichlorophenyl)methyl]-2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-imine;hydrochloride |
|---|---|
| PubChem CID | 6603513 |
| Molecular Formula | C19H21Cl3N2 |
| Molecular Weight | 383.75 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methyl]-2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-imine;hydrochloride |
| SMILES | Cl.[H]/N=c1/c2c(n(Cc3ccc(Cl)cc3Cl)c3c1CCC3)CCCC2 |
| InChI | InChI=1S/C19H20Cl2N2.ClH/c20-13-9-8-12(16(21)10-13)11-23-17-6-2-1-4-14(17)19(22)15-5-3-7-18(15)23;/h8-10,22H,1-7,11H2;1H/b22-19-; |
| InChIKey | SXACIBZJAIIGBV-GXTSIBQPSA-N |
| XLogP | 5.11 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.75 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |