About 2-(4-methyl-1,3-thiazol-5-yl)ethyl pyridine-3-carboxylate;hydrochloride
2-(4-methyl-1,3-thiazol-5-yl)ethyl pyridine-3-carboxylate;hydrochloride (PubChem CID 6603528) has the molecular formula C12H13ClN2O2S
and a molecular weight of 284.77 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-5-yl)ethyl pyridine-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl pyridine-3-carboxylate;hydrochloride |
| PubChem CID | 6603528 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl pyridine-3-carboxylate;hydrochloride |
| SMILES | Cc1ncsc1CCOC(=O)c1cccnc1.Cl |
| InChI | InChI=1S/C12H12N2O2S.ClH/c1-9-11(17-8-14-9)4-6-16-12(15)10-3-2-5-13-7-10;/h2-3,5,7-8H,4,6H2,1H3;1H |
| InChIKey | QQYBRPIUNVIUEM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-methyl-1,3-thiazol-5-yl)ethyl pyridine-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,3-thiazol-5-yl)ethyl pyridine-3-carboxylate;hydrochloride?
The IUPAC name of 2-(4-methyl-1,3-thiazol-5-yl)ethyl pyridine-3-carboxylate;hydrochloride (CID 6603528) is 2-(4-methyl-1,3-thiazol-5-yl)ethyl pyridine-3-carboxylate;hydrochloride.
What is the SMILES notation for 2-(4-methyl-1,3-thiazol-5-yl)ethyl pyridine-3-carboxylate;hydrochloride?
The canonical SMILES for 2-(4-methyl-1,3-thiazol-5-yl)ethyl pyridine-3-carboxylate;hydrochloride is Cc1ncsc1CCOC(=O)c1cccnc1.Cl.
What is the InChIKey of 2-(4-methyl-1,3-thiazol-5-yl)ethyl pyridine-3-carboxylate;hydrochloride?
The InChIKey is QQYBRPIUNVIUEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2S.ClH/c1-9-11(17-8-14-9)4-6-16-12(15)10-3-2-5-13-7-10;/h2-3,5,7-8H,4,6H2,1H3;1H.
What are the key properties of 2-(4-methyl-1,3-thiazol-5-yl)ethyl pyridine-3-carboxylate;hydrochloride?
2-(4-methyl-1,3-thiazol-5-yl)ethyl pyridine-3-carboxylate;hydrochloride has a molecular weight of 284.77 g/mol, XLogP of 2.67, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,3-thiazol-5-yl)ethyl pyridine-3-carboxylate;hydrochloride is sourced from PubChem (CID 6603528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).