About 1,3-dimethyl-3,4-dihydroisoquinoline;hydrochloride
1,3-dimethyl-3,4-dihydroisoquinoline;hydrochloride (PubChem CID 6603531) has the molecular formula C11H14ClN
and a molecular weight of 195.69 g/mol. Its IUPAC name is 1,3-dimethyl-3,4-dihydroisoquinoline;hydrochloride.
Molecular Properties
| Compound Name | 1,3-dimethyl-3,4-dihydroisoquinoline;hydrochloride |
| PubChem CID | 6603531 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 1,3-dimethyl-3,4-dihydroisoquinoline;hydrochloride |
| SMILES | CC1=NC(C)Cc2ccccc21.Cl |
| InChI | InChI=1S/C11H13N.ClH/c1-8-7-10-5-3-4-6-11(10)9(2)12-8;/h3-6,8H,7H2,1-2H3;1H |
| InChIKey | PRBDJXKSJWUOLU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-dimethyl-3,4-dihydroisoquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-3,4-dihydroisoquinoline;hydrochloride?
The IUPAC name of 1,3-dimethyl-3,4-dihydroisoquinoline;hydrochloride (CID 6603531) is 1,3-dimethyl-3,4-dihydroisoquinoline;hydrochloride.
What is the SMILES notation for 1,3-dimethyl-3,4-dihydroisoquinoline;hydrochloride?
The canonical SMILES for 1,3-dimethyl-3,4-dihydroisoquinoline;hydrochloride is CC1=NC(C)Cc2ccccc21.Cl.
What is the InChIKey of 1,3-dimethyl-3,4-dihydroisoquinoline;hydrochloride?
The InChIKey is PRBDJXKSJWUOLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N.ClH/c1-8-7-10-5-3-4-6-11(10)9(2)12-8;/h3-6,8H,7H2,1-2H3;1H.
What are the key properties of 1,3-dimethyl-3,4-dihydroisoquinoline;hydrochloride?
1,3-dimethyl-3,4-dihydroisoquinoline;hydrochloride has a molecular weight of 195.69 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-3,4-dihydroisoquinoline;hydrochloride is sourced from PubChem (CID 6603531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).