About 4-(2-piperidin-1-ylethyl)-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride
4-(2-piperidin-1-ylethyl)-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride (PubChem CID 6603556) has the molecular formula C16H23ClN4
and a molecular weight of 306.84 g/mol. Its IUPAC name is 4-(2-piperidin-1-ylethyl)-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride.
Molecular Properties
| Compound Name | 4-(2-piperidin-1-ylethyl)-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride |
| PubChem CID | 6603556 |
| Molecular Formula | C16H23ClN4 |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 4-(2-piperidin-1-ylethyl)-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride |
| SMILES | Cl.c1ccc2c(c1)N1CCN=C1N2CCN1CCCCC1 |
| InChI | InChI=1S/C16H22N4.ClH/c1-4-9-18(10-5-1)12-13-20-15-7-3-2-6-14(15)19-11-8-17-16(19)20;/h2-3,6-7H,1,4-5,8-13H2;1H |
| InChIKey | RQHTWKHJBPHKBW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-piperidin-1-ylethyl)-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-piperidin-1-ylethyl)-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride?
The IUPAC name of 4-(2-piperidin-1-ylethyl)-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride (CID 6603556) is 4-(2-piperidin-1-ylethyl)-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride.
What is the SMILES notation for 4-(2-piperidin-1-ylethyl)-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride?
The canonical SMILES for 4-(2-piperidin-1-ylethyl)-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride is Cl.c1ccc2c(c1)N1CCN=C1N2CCN1CCCCC1.
What is the InChIKey of 4-(2-piperidin-1-ylethyl)-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride?
The InChIKey is RQHTWKHJBPHKBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4.ClH/c1-4-9-18(10-5-1)12-13-20-15-7-3-2-6-14(15)19-11-8-17-16(19)20;/h2-3,6-7H,1,4-5,8-13H2;1H.
What are the key properties of 4-(2-piperidin-1-ylethyl)-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride?
4-(2-piperidin-1-ylethyl)-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride has a molecular weight of 306.84 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-piperidin-1-ylethyl)-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride is sourced from PubChem (CID 6603556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).