About N-(1-phenylethyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride
N-(1-phenylethyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride (PubChem CID 6603563) has the molecular formula C12H17ClN2
and a molecular weight of 224.74 g/mol. Its IUPAC name is N-(1-phenylethyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(1-phenylethyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride |
| PubChem CID | 6603563 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.74 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | N-(1-phenylethyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride |
| SMILES | CC(NC1=NCCC1)c1ccccc1.Cl |
| InChI | InChI=1S/C12H16N2.ClH/c1-10(11-6-3-2-4-7-11)14-12-8-5-9-13-12;/h2-4,6-7,10H,5,8-9H2,1H3,(H,13,14);1H |
| InChIKey | HZANNJPHUWWYJH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.74 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-phenylethyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-phenylethyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride?
The IUPAC name of N-(1-phenylethyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride (CID 6603563) is N-(1-phenylethyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride.
What is the SMILES notation for N-(1-phenylethyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride?
The canonical SMILES for N-(1-phenylethyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride is CC(NC1=NCCC1)c1ccccc1.Cl.
What is the InChIKey of N-(1-phenylethyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride?
The InChIKey is HZANNJPHUWWYJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2.ClH/c1-10(11-6-3-2-4-7-11)14-12-8-5-9-13-12;/h2-4,6-7,10H,5,8-9H2,1H3,(H,13,14);1H.
What are the key properties of N-(1-phenylethyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride?
N-(1-phenylethyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride has a molecular weight of 224.74 g/mol, XLogP of 2.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-phenylethyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride is sourced from PubChem (CID 6603563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).