About [3-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2-methylbenzoate;hydrochloride
[3-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2-methylbenzoate;hydrochloride (PubChem CID 6603576) has the molecular formula C17H20ClNO3
and a molecular weight of 321.80 g/mol. Its IUPAC name is [3-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2-methylbenzoate;hydrochloride.
Molecular Properties
| Compound Name | [3-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2-methylbenzoate;hydrochloride |
| PubChem CID | 6603576 |
| Molecular Formula | C17H20ClNO3 |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | [3-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2-methylbenzoate;hydrochloride |
| SMILES | CNCC(O)c1cccc(OC(=O)c2ccccc2C)c1.Cl |
| InChI | InChI=1S/C17H19NO3.ClH/c1-12-6-3-4-9-15(12)17(20)21-14-8-5-7-13(10-14)16(19)11-18-2;/h3-10,16,18-19H,11H2,1-2H3;1H |
| InChIKey | QZRYPZYDCWQNGN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2-methylbenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2-methylbenzoate;hydrochloride?
The IUPAC name of [3-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2-methylbenzoate;hydrochloride (CID 6603576) is [3-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2-methylbenzoate;hydrochloride.
What is the SMILES notation for [3-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2-methylbenzoate;hydrochloride?
The canonical SMILES for [3-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2-methylbenzoate;hydrochloride is CNCC(O)c1cccc(OC(=O)c2ccccc2C)c1.Cl.
What is the InChIKey of [3-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2-methylbenzoate;hydrochloride?
The InChIKey is QZRYPZYDCWQNGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO3.ClH/c1-12-6-3-4-9-15(12)17(20)21-14-8-5-7-13(10-14)16(19)11-18-2;/h3-10,16,18-19H,11H2,1-2H3;1H.
What are the key properties of [3-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2-methylbenzoate;hydrochloride?
[3-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2-methylbenzoate;hydrochloride has a molecular weight of 321.80 g/mol, XLogP of 2.89, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2-methylbenzoate;hydrochloride is sourced from PubChem (CID 6603576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).