About 1-benzyl-4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazine;hydrochloride
1-benzyl-4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazine;hydrochloride (PubChem CID 6603587) has the molecular formula C17H23ClN2O2S2
and a molecular weight of 386.97 g/mol. Its IUPAC name is 1-benzyl-4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazine;hydrochloride.
Molecular Properties
| Compound Name | 1-benzyl-4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazine;hydrochloride |
| PubChem CID | 6603587 |
| Molecular Formula | C17H23ClN2O2S2 |
| Molecular Weight | 386.97 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 1-benzyl-4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazine;hydrochloride |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(Cc3ccccc3)CC2)c(C)s1.Cl |
| InChI | InChI=1S/C17H22N2O2S2.ClH/c1-14-12-17(15(2)22-14)23(20,21)19-10-8-18(9-11-19)13-16-6-4-3-5-7-16;/h3-7,12H,8-11,13H2,1-2H3;1H |
| InChIKey | UVOSPKRZHGMIGZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.97 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazine;hydrochloride?
The IUPAC name of 1-benzyl-4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazine;hydrochloride (CID 6603587) is 1-benzyl-4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazine;hydrochloride.
What is the SMILES notation for 1-benzyl-4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazine;hydrochloride?
The canonical SMILES for 1-benzyl-4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazine;hydrochloride is Cc1cc(S(=O)(=O)N2CCN(Cc3ccccc3)CC2)c(C)s1.Cl.
What is the InChIKey of 1-benzyl-4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazine;hydrochloride?
The InChIKey is UVOSPKRZHGMIGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2S2.ClH/c1-14-12-17(15(2)22-14)23(20,21)19-10-8-18(9-11-19)13-16-6-4-3-5-7-16;/h3-7,12H,8-11,13H2,1-2H3;1H.
What are the key properties of 1-benzyl-4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazine;hydrochloride?
1-benzyl-4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazine;hydrochloride has a molecular weight of 386.97 g/mol, XLogP of 3.29, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazine;hydrochloride is sourced from PubChem (CID 6603587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).